GSK3326595 (EPZ015938)
-
Total: $0.00
$0.00
| Unit | Price | Qty |
|---|---|---|
| 5 mg | $110.00 |
|
| 10 mg | $175.00 |
|
Select A Tab:
Novel inhibitor of the spindle checkpoint function of Monospindle 1 (Mps1, also known as TTK)
| Technical Data | |
| Chemical Formula | C24H32N6O3 |
| CAS Number | 1616392-22-3 |
| Molecular Weight | 452.56 |
| Solubility | DMSO |
| IUPAC/Chemical Name | EPZ015938 |
| Purity | 98% by HPLC |
| Storage | 0°C (short term), -20°C (long term), desiccated |
| InChI Key | JLCCNYVTIWRPIZ-NRFANRHFSA-N |
| InChl Code | GSK 3326595 |
| Smiles | O=C(C)N1CCC(NC2=NC=NC(C(NC[C@H](O)CN3CCC(C=CC=C4)=C4C3)=O)=C2)CC1 |
| References | GSK3326595 |
| Synonym | GSK-3326595 |