NVP-2
-
Total: $0.00
$0.00
| Unit | Price | Qty |
|---|---|---|
| 5 mg | $165.00 |
|
| 10 mg | $262.50 |
|
Select A Tab:
Novel selective and ATP-competitive inhibitor of the cyclin-dependent kinase CDK9
| Technical Data | |
| Chemical Formula | C27H37ClN6O2 |
| CAS Number | 1263373-43-8 |
| Molecular Weight | 513.07 |
| Solubility | DMSO or EtOH 51.31 mg per 1 mL |
| IUPAC/Chemical Name | 4-[[[5'-Chloro-2'-[[trans-4-[[(1R)-2-methoxy-1-methylethyl]amino]cyclohexyl]amino][2,4'-bipyridin]-6-yl]amino]methyl]tetrahydro-2H-pyran-4-carbonitrile |
| Purity | 98% by HPLC |
| Storage | 0°C (short term), -20°C (long term), desiccated |
| InChI Key | XWQVQSXLXAXOPJ-QNGMFEMESA-N |
| Smiles | COC[C@H](N[C@H]1CC[C@H](NC2=CC(C3=NC(NCC4(C#N)CCOCC4)=CC=C3)=C(C=N2)Cl)CC1)C |
| References | 1) Olson et al (2018) Pharmacological perturbation of CDK9 using selective CDK9 inhibition or degradation. Nat.Chem.Biol. 14 163 PMID |
| PubChem ID | 66937006 |