Supinoxin (RX-5902)
-
Total: $0.00
$0.00
| Unit | Price | Qty |
|---|---|---|
| 5 mg | $110.00 |
|
| 10 mg | $175.00 |
|
Select A Tab:
Novel inhibitor of p68 RNA helicase, inhibiting the β-catenin dependent ATPase activity of p68 RNA helicase
| Technical Data | |
| Chemical Formula | C22H24FN5O4 |
| CAS Number | 888478-45-3 |
| Molecular Weight | 441.46 |
| Solubility | DMSO |
| IUPAC/Chemical Name | RX5902 |
| Purity | 98% by HPLC |
| Storage | 0°C (short term), -20°C (long term), desiccated |
| InChI Key | KAKPGJJRYRYSTP-UHFFFAOYSA-N |
| InChl Code | RX5902 |
| Smiles | O=C(N1CCN(C2=CC(OC)=CC(OC)=C2)CC1)NC3=NC4=CC(F)=CC=C4N=C3OC |
| Synonym | Supinoxin |