LOXO-195 (Selitrectinib)
-
Total: $0.00
$0.00
| Unit | Price | Qty |
|---|---|---|
| 5 mg | $110.00 |
|
| 10 mg | $175.00 |
|
Select A Tab:
Next-generation, selective TRK inhibitor, overcoming the resistance for larotrectinib (LOXO-101) or multikinase inhibitors with anti-TRK activity
| Technical Data | |
| Chemical Formula | C20H21FN6O |
| CAS Number | 2097002-61-2 |
| Molecular Weight | 380.43 |
| Solubility | DMSO |
| IUPAC/Chemical Name | BAY 2731954 |
| Purity | 98% by HPLC |
| Storage | 0°C (short term), -20°C (long term), desiccated |
| InChI Key | OEBIHOVSAMBXIB-SJKOYZFVSA-N |
| InChl Code | LOXO 195 |
| Smiles | FC1=CN=C(CC[C@@H](C)NC(C2=C3N(C=CC4=N3)N=C2)=O)C([C@@H]5N4CCC5)=C1 |
| References | LOXO195 |
| Synonym | LOXO-195 |